معرفی شرکت ها
chemdraw-0.0.5
تبلیغات ما
مشتریان به طور فزاینده ای آنلاین هستند. تبلیغات می تواند به آنها کمک کند تا کسب و کار شما را پیدا کنند.
مشاهده بیشتر
تبلیغات ما
مشتریان به طور فزاینده ای آنلاین هستند. تبلیغات می تواند به آنها کمک کند تا کسب و کار شما را پیدا کنند.
مشاهده بیشتر
تبلیغات ما
مشتریان به طور فزاینده ای آنلاین هستند. تبلیغات می تواند به آنها کمک کند تا کسب و کار شما را پیدا کنند.
مشاهده بیشتر
تبلیغات ما
مشتریان به طور فزاینده ای آنلاین هستند. تبلیغات می تواند به آنها کمک کند تا کسب و کار شما را پیدا کنند.
مشاهده بیشتر
تبلیغات ما
مشتریان به طور فزاینده ای آنلاین هستند. تبلیغات می تواند به آنها کمک کند تا کسب و کار شما را پیدا کنند.
مشاهده بیشترتوضیحات
Drawing molecules
| ویژگی | مقدار |
|---|---|
| سیستم عامل | - |
| نام فایل | chemdraw-0.0.5 |
| نام | chemdraw |
| نسخه کتابخانه | 0.0.5 |
| نگهدارنده | [] |
| ایمیل نگهدارنده | [] |
| نویسنده | Dylan Walsh |
| ایمیل نویسنده | - |
| آدرس صفحه اصلی | https://github.com/dylanwal/chemdraw |
| آدرس اینترنتی | https://pypi.org/project/chemdraw/ |
| مجوز | BSD |
# ChemDraw
---
Draw molecules with [Plotly](https://github.com/plotly/plotly.py).
**Make molecules look the way you want it!**
The package provides global control of aesthetics with `config`, and allows for local control by specifying details
for every atom, bond, and ring.
(Development still in progress. So there are some bugs. But its working pretty well so far!)
---
## Installation
Pip installable package available.
`pip install chemdraw`
[pypi: chemdraw](https://pypi.org/project/chemdraw/)
---
---
## Dependencies
* [numpy](https://github.com/numpy/numpy) (1.23.1)
* Used for math
* [plotly](https://github.com/plotly/plotly.py) (5.9.0)
* Plots molecules
* [kaleido](https://github.com/plotly/Kaleido) (0.1.0post1)
* Converts plotly graphs to images (png, svg, etc.)
* I am not using the most recent version of kaleido as it does not play nice with my computer. Try the newest
version, but if you are having issues install this specific version.
* [rdkit](https://github.com/rdkit/rdkit) (2022.3.4)
* Convert SMILES to position coordinates.
* [Pillow](https://github.com/python-pillow/Pillow) (9.2.0)
* Used for image manipulation.
* [scikit-learn](https://github.com/scikit-learn/scikit-learn) (1.1.1)
* Used to reorient molecules.
---
---
# Examples:
(Image may be distorted from viewer, but real image is not.)
## Basic Usage
```python
import chemdraw
mol = "O=C(C)Oc1ccccc1C(=O)O"
drawer = chemdraw.Drawer(mol, title=mol)
fig = drawer.draw()
fig.show()
```
---
## Grid
```python
import chemdraw
molecules = [
"CCCCCCCCCC",
"CC(CC(CCC)C)CC",
"CCC1CC1",
"C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)O",
"O=C(C)Oc1ccccc1C(=O)O",
"C1(CCC2)=C3C2=CC4=C5C3=C(CCC5CCC4)C=C1",
"CC(C)(C)N(C)C(=O)C14C3C2C1C5C2C3C45C(=O)C69C8C7C6C%10C7C8C9%10",
"CC3C(C(=O)OCC1=CCN2C1C(CC2)OC(=O)C(CC(=O)O3)(C(C)C)O)(C(C)C)O",
"N#CCC1(CC(O1)C2=CC(=NC2=O)OC)O"
]
drawer = chemdraw.GridDrawer(molecules)
drawer.draw_png("example_2.png")
```
---
## Atom, Bond, and Ring Numbers
Atom Numbers (black text)
Bond Numbers (gray text)
Ring Numbers (maroon text)
```python
import chemdraw
mol = "C1(CCC2)=C3C2=CC4=C5C3=C(CCC5CCC4)C=C1"
config = chemdraw.Config()
config.atom_numbers.show = True
config.bond_numbers.show = True
config.ring_numbers.show = True
drawer = chemdraw.Drawer(mol, title=mol, config=config)
fig = drawer.draw()
fig.show()
```
---
## Ring Highlights
```python
import chemdraw
mol = "C1(CCC2)=C3C2=CC4=C5C3=C(CCC5CCC4)C=C1"
molecule = chemdraw.Molecule(mol)
for ring in molecule.rings:
ring.highlight.show = True # all rings are highlighted (with default highlight_color)
if ring.aromatic: # highlighted aromatic green
ring.highlight.color = "rgba(0,255,0,0.5)"
drawer = chemdraw.Drawer(molecule, title=mol, config=config)
fig = drawer.draw()
fig.show()
```
---
## Atom and Bond Highlights
```python
import chemdraw
mol = "C1(CCC2)=C3C2=CC4=C5C3=C(CCC5CCC4)C=C1"
molecule = chemdraw.Molecule(mol)
# highlight outer ring bonds and atoms
bond_ids = [0, 1, 2, 19, 5, 6, 21, 15, 14, 13, 12, 11, 10, 16, 17, 18]
for id_ in bond_ids:
molecule.bonds[id_].highlight.show = True
for atom in molecule.atoms:
atom.highlight.show = True
# highlight inner bonds and atoms
accent_color = "rgb(252,186,63)"
molecule.bonds[8].highlight.show = True
molecule.bonds[8].highlight.color = accent_color
molecule.bonds[20].highlight.show = True
molecule.bonds[20].highlight.color = accent_color
atoms_ids = [4, 8, 9]
for id_ in atoms_ids:
molecule.atoms[id_].highlight.color = accent_color
drawer = chemdraw.Drawer(molecule, title=mol, config=config)
fig = drawer.draw()
fig.show()
```
---
## Polymers
From mole file
```python
import chemdraw
mole_file_name = "ketcher_mol_file.txt"
mol = chemdraw.Molecule(mole_file=mole_file_name)
drawer = chemdraw.Drawer(mol)
fig = drawer.draw()
fig.show()
```
Add parenthesis to a SMILES
```python
import chemdraw
mol = chemdraw.Molecule("OC(=O)CCCCC(=O)NCCCCCCN")
mol.add_parenthesis([0, 15], sub_script="n")
drawer = chemdraw.Drawer(mol)
fig = drawer.draw()
fig.show()
```
---
---
# Mole Files
You can also pass a file path to mole files into 'Molecule'.
Support for V2000 only.
```python
import chemdraw
mole_file_name = "examples/mol_files/poly_diblock.txt"
mol = chemdraw.Molecule(mole_file=mole_file_name)
molecule_drawer = chemdraw.Drawer(mol)
fig = molecule_drawer.draw()
fig.show()
```
# More Info
For more information on how the code works see:
[chemdraw.README.md](https://github.com/dylanwal/chemdraw/tree/master/chemdraw)
نیازمندی
| مقدار | نام |
|---|---|
| >=1.23.1 | numpy |
| >=5.9.0 | plotly |
| >=0.1.0 | kaleido |
| >=2022.3.4 | rdkit |
| >=9.2.0 | Pillow |
| >=1.1.1 | scikit-learn |
زبان مورد نیاز
| مقدار | نام |
|---|---|
| >=3.10 | Python |
نحوه نصب
نصب پکیج whl chemdraw-0.0.5:
pip install chemdraw-0.0.5.whl
نصب پکیج tar.gz chemdraw-0.0.5:
pip install chemdraw-0.0.5.tar.gz